C24H35NO6 — CID 54157671
2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[1-(2-oxo-2-phenylmethoxyethyl)cyclopentyl]pentanoic acid (PubChem CID 54157671) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[1-(2-oxo-2-phenylmethoxyethyl)cyclopentyl]pentanoic acid.
| Compound Name | 2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[1-(2-oxo-2-phenylmethoxyethyl)cyclopentyl]pentanoic acid |
|---|---|
| PubChem CID | 54157671 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[1-(2-oxo-2-phenylmethoxyethyl)cyclopentyl]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)C(N)(CCCC1(CC(=O)OCc2ccccc2)CCCC1)C(=O)O |
| InChI | InChI=1S/C24H35NO6/c1-22(2,3)31-21(29)24(25,20(27)28)15-9-14-23(12-7-8-13-23)16-19(26)30-17-18-10-5-4-6-11-18/h4-6,10-11H,7-9,12-17,25H2,1-3H3,(H,27,28) |
| InChIKey | OMFSUKFJNJMEKE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|