C24H31NO4 — CID 91388313
tert-butyl 2-[1-(2-oxo-2-phenylmethoxyethyl)cyclohexyl]-1H-pyrrole-3-carboxylate (PubChem CID 91388313) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl 2-[1-(2-oxo-2-phenylmethoxyethyl)cyclohexyl]-1H-pyrrole-3-carboxylate.
| Compound Name | tert-butyl 2-[1-(2-oxo-2-phenylmethoxyethyl)cyclohexyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 91388313 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | tert-butyl 2-[1-(2-oxo-2-phenylmethoxyethyl)cyclohexyl]-1H-pyrrole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc[nH]c1C1(CC(=O)OCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C24H31NO4/c1-23(2,3)29-22(27)19-12-15-25-21(19)24(13-8-5-9-14-24)16-20(26)28-17-18-10-6-4-7-11-18/h4,6-7,10-12,15,25H,5,8-9,13-14,16-17H2,1-3H3 |
| InChIKey | AMNOVDZDVSZVPQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |