C20H29NO4 — CID 67428133
tert-butyl 3-[1-(phenylmethoxycarbonylamino)cyclopentyl]propanoate (PubChem CID 67428133) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is tert-butyl 3-[1-(phenylmethoxycarbonylamino)cyclopentyl]propanoate.
| Compound Name | tert-butyl 3-[1-(phenylmethoxycarbonylamino)cyclopentyl]propanoate |
|---|---|
| PubChem CID | 67428133 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | tert-butyl 3-[1-(phenylmethoxycarbonylamino)cyclopentyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCC1(NC(=O)OCc2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H29NO4/c1-19(2,3)25-17(22)11-14-20(12-7-8-13-20)21-18(23)24-15-16-9-5-4-6-10-16/h4-6,9-10H,7-8,11-15H2,1-3H3,(H,21,23) |
| InChIKey | JLMDTCDCWSOOGD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |