C17H25NO6S — CID 138606235
tert-butyl 3-[2-(phenylmethoxycarbonylamino)ethylsulfonyl]propanoate (PubChem CID 138606235) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is tert-butyl 3-[2-(phenylmethoxycarbonylamino)ethylsulfonyl]propanoate.
| Compound Name | tert-butyl 3-[2-(phenylmethoxycarbonylamino)ethylsulfonyl]propanoate |
|---|---|
| PubChem CID | 138606235 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | tert-butyl 3-[2-(phenylmethoxycarbonylamino)ethylsulfonyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCS(=O)(=O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO6S/c1-17(2,3)24-15(19)9-11-25(21,22)12-10-18-16(20)23-13-14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3,(H,18,20) |
| InChIKey | ZUPMDUNZTHTLDC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |