C19H28N2O5 — CID 175984767
tert-butyl (3S)-3-(methoxymethyl)-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate (PubChem CID 175984767) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is tert-butyl (3S)-3-(methoxymethyl)-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(methoxymethyl)-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175984767 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | tert-butyl (3S)-3-(methoxymethyl)-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate |
| SMILES | COC[C@]1(NC(=O)OCc2ccccc2)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H28N2O5/c1-18(2,3)26-17(23)21-11-10-19(13-21,14-24-4)20-16(22)25-12-15-8-6-5-7-9-15/h5-9H,10-14H2,1-4H3,(H,20,22)/t19-/m0/s1 |
| InChIKey | YTATVMLEUUXAQL-IBGZPJMESA-N |
| XLogP | 2.94 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |