C19H27N3O6 — CID 118370052
tert-butyl 3-(hydroxycarbamoyl)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 118370052) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl 3-(hydroxycarbamoyl)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydroxycarbamoyl)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118370052 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | tert-butyl 3-(hydroxycarbamoyl)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NC(=O)OCc2ccccc2)(C(=O)NO)C1 |
| InChI | InChI=1S/C19H27N3O6/c1-18(2,3)28-17(25)22-11-7-10-19(13-22,15(23)21-26)20-16(24)27-12-14-8-5-4-6-9-14/h4-6,8-9,26H,7,10-13H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | NVZQGGKVNWHWFH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|