C25H36N2O4 — CID 71305291
1-O-benzyl 1-O'-tert-butyl (3aR,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-2H-indole-3,3'-piperidine]-1,1'-dicarboxylate (PubChem CID 71305291) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 1-O-benzyl 1-O'-tert-butyl (3aR,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-2H-indole-3,3'-piperidine]-1,1'-dicarboxylate.
| Compound Name | 1-O-benzyl 1-O'-tert-butyl (3aR,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-2H-indole-3,3'-piperidine]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 71305291 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-O-benzyl 1-O'-tert-butyl (3aR,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-2H-indole-3,3'-piperidine]-1,1'-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CN(C(=O)OCc1ccccc1)[C@@H]1CCCC[C@@H]12 |
| InChI | InChI=1S/C25H36N2O4/c1-24(2,3)31-22(28)26-15-9-14-25(17-26)18-27(21-13-8-7-12-20(21)25)23(29)30-16-19-10-5-4-6-11-19/h4-6,10-11,20-21H,7-9,12-18H2,1-3H3/t20-,21+,25?/m0/s1 |
| InChIKey | MUUSWVJRMMMHDJ-SXNCYPNXSA-N |
| XLogP | 5.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |