C20H29N3O4 — CID 70314406
2-O-benzyl 3-O-tert-butyl (3S,3aS,6aR)-3a,6a-diamino-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 70314406) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-O-benzyl 3-O-tert-butyl (3S,3aS,6aR)-3a,6a-diamino-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-tert-butyl (3S,3aS,6aR)-3a,6a-diamino-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 70314406 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-O-benzyl 3-O-tert-butyl (3S,3aS,6aR)-3a,6a-diamino-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1N(C(=O)OCc2ccccc2)C[C@]2(N)CCC[C@]12N |
| InChI | InChI=1S/C20H29N3O4/c1-18(2,3)27-16(24)15-20(22)11-7-10-19(20,21)13-23(15)17(25)26-12-14-8-5-4-6-9-14/h4-6,8-9,15H,7,10-13,21-22H2,1-3H3/t15-,19-,20+/m1/s1 |
| InChIKey | SNKGZFYWZZBPMZ-YSGRDPCXSA-N |
| XLogP | 1.93 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |