C17H24N2O4 — CID 53442652
1-O-benzyl 3-O-tert-butyl 2-aminopyrrolidine-1,3-dicarboxylate (PubChem CID 53442652) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-O-benzyl 3-O-tert-butyl 2-aminopyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-tert-butyl 2-aminopyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 53442652 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-O-benzyl 3-O-tert-butyl 2-aminopyrrolidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCN(C(=O)OCc2ccccc2)C1N |
| InChI | InChI=1S/C17H24N2O4/c1-17(2,3)23-15(20)13-9-10-19(14(13)18)16(21)22-11-12-7-5-4-6-8-12/h4-8,13-14H,9-11,18H2,1-3H3 |
| InChIKey | JRBKUWVIXPIARC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |