C27H32N2O6 — CID 170612287
4-O,5-O-dibenzyl 1-O-tert-butyl (3aS,4R,6aR)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,4,5-tricarboxylate (PubChem CID 170612287) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is 4-O,5-O-dibenzyl 1-O-tert-butyl (3aS,4R,6aR)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,4,5-tricarboxylate.
| Compound Name | 4-O,5-O-dibenzyl 1-O-tert-butyl (3aS,4R,6aR)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,4,5-tricarboxylate |
|---|---|
| PubChem CID | 170612287 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-O,5-O-dibenzyl 1-O-tert-butyl (3aS,4R,6aR)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,4,5-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H]1CN(C(=O)OCc1ccccc1)[C@H]2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H32N2O6/c1-27(2,3)35-26(32)28-15-14-21-22(28)16-29(25(31)34-18-20-12-8-5-9-13-20)23(21)24(30)33-17-19-10-6-4-7-11-19/h4-13,21-23H,14-18H2,1-3H3/t21-,22-,23+/m0/s1 |
| InChIKey | HHZZZBLHDYFDAA-RJGXRXQPSA-N |
| XLogP | 4.38 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|