C28H27NO6 — CID 10648165
tribenzyl (2S,3R)-pyrrolidine-1,2,3-tricarboxylate (PubChem CID 10648165) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is tribenzyl (2S,3R)-pyrrolidine-1,2,3-tricarboxylate.
| Compound Name | tribenzyl (2S,3R)-pyrrolidine-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10648165 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | tribenzyl (2S,3R)-pyrrolidine-1,2,3-tricarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1[C@H](C(=O)OCc2ccccc2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H27NO6/c30-26(33-18-21-10-4-1-5-11-21)24-16-17-29(28(32)35-20-23-14-8-3-9-15-23)25(24)27(31)34-19-22-12-6-2-7-13-22/h1-15,24-25H,16-20H2/t24-,25+/m1/s1 |
| InChIKey | BKTSGLWEKKWNPN-RPBOFIJWSA-N |
| XLogP | 4.50 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|