C20H22ClNO5 — CID 18346184
dibenzyl (2S)-3-hydroxypyrrolidine-1,2-dicarboxylate;hydrochloride (PubChem CID 18346184) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is dibenzyl (2S)-3-hydroxypyrrolidine-1,2-dicarboxylate;hydrochloride.
| Compound Name | dibenzyl (2S)-3-hydroxypyrrolidine-1,2-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 18346184 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | dibenzyl (2S)-3-hydroxypyrrolidine-1,2-dicarboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)[C@@H]1C(O)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO5.ClH/c22-17-11-12-21(20(24)26-14-16-9-5-2-6-10-16)18(17)19(23)25-13-15-7-3-1-4-8-15;/h1-10,17-18,22H,11-14H2;1H/t17?,18-;/m0./s1 |
| InChIKey | NUQRYAYUQIRWEH-SZOUEMSFSA-N |
| XLogP | 2.92 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |