C14H17NO3S — CID 131712678
(2R,3R)-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carbothioic S-acid (PubChem CID 131712678) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is (2R,3R)-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carbothioic S-acid.
| Compound Name | (2R,3R)-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carbothioic S-acid |
|---|---|
| PubChem CID | 131712678 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (2R,3R)-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carbothioic S-acid |
| SMILES | C[C@@H]1CCN(C(=O)OCc2ccccc2)[C@H]1C(=O)S |
| InChI | InChI=1S/C14H17NO3S/c1-10-7-8-15(12(10)13(16)19)14(17)18-9-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3,(H,16,19)/t10-,12-/m1/s1 |
| InChIKey | ANUPMJRYMWYUEK-ZYHUDNBSSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|