C19H25NO4 — CID 58051374
(2S,3R)-3-cyclohexyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 58051374) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2S,3R)-3-cyclohexyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R)-3-cyclohexyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58051374 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (2S,3R)-3-cyclohexyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C2CCCCC2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c21-18(22)17-16(15-9-5-2-6-10-15)11-12-20(17)19(23)24-13-14-7-3-1-4-8-14/h1,3-4,7-8,15-17H,2,5-6,9-13H2,(H,21,22)/t16-,17+/m1/s1 |
| InChIKey | BVHPXPOVDDVFQT-SJORKVTESA-N |
| XLogP | 3.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |