C16H21NO8P+ — CID 57025836
[2-(2-carboxy-1-phenylmethoxycarbonylpiperidin-3-yl)-2-oxoethyl]-trihydroxyphosphanium (PubChem CID 57025836) has the molecular formula C16H21NO8P+ and a molecular weight of 386.32 g/mol. Its IUPAC name is [2-(2-carboxy-1-phenylmethoxycarbonylpiperidin-3-yl)-2-oxoethyl]-trihydroxyphosphanium.
| Compound Name | [2-(2-carboxy-1-phenylmethoxycarbonylpiperidin-3-yl)-2-oxoethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 57025836 |
| Molecular Formula | C16H21NO8P+ |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [2-(2-carboxy-1-phenylmethoxycarbonylpiperidin-3-yl)-2-oxoethyl]-trihydroxyphosphanium |
| SMILES | O=C(C[P+](O)(O)O)C1CCCN(C(=O)OCc2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C16H20NO8P/c18-13(10-26(22,23)24)12-7-4-8-17(14(12)15(19)20)16(21)25-9-11-5-2-1-3-6-11/h1-3,5-6,12,14,22-24H,4,7-10H2/p+1 |
| InChIKey | DYKDOZPTIKTNKH-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|