C18H26N2O5 — CID 66677249
4-O-benzyl 1-O-ethyl (3S,4R)-2-amino-3-ethoxypiperidine-1,4-dicarboxylate (PubChem CID 66677249) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-O-benzyl 1-O-ethyl (3S,4R)-2-amino-3-ethoxypiperidine-1,4-dicarboxylate.
| Compound Name | 4-O-benzyl 1-O-ethyl (3S,4R)-2-amino-3-ethoxypiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 66677249 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-O-benzyl 1-O-ethyl (3S,4R)-2-amino-3-ethoxypiperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)N1CC[C@@H](C(=O)OCc2ccccc2)[C@H](OCC)C1N |
| InChI | InChI=1S/C18H26N2O5/c1-3-23-15-14(10-11-20(16(15)19)18(22)24-4-2)17(21)25-12-13-8-6-5-7-9-13/h5-9,14-16H,3-4,10-12,19H2,1-2H3/t14-,15+,16?/m1/s1 |
| InChIKey | VMVIWVIPFGWITR-YSPPHNQVSA-N |
| XLogP | 1.90 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |