C22H32N2O6 — CID 118427975
2-O-benzyl 1-O,4-O-ditert-butyl piperazine-1,2,4-tricarboxylate (PubChem CID 118427975) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-O-benzyl 1-O,4-O-ditert-butyl piperazine-1,2,4-tricarboxylate.
| Compound Name | 2-O-benzyl 1-O,4-O-ditert-butyl piperazine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 118427975 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-O-benzyl 1-O,4-O-ditert-butyl piperazine-1,2,4-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C22H32N2O6/c1-21(2,3)29-19(26)23-12-13-24(20(27)30-22(4,5)6)17(14-23)18(25)28-15-16-10-8-7-9-11-16/h7-11,17H,12-15H2,1-6H3 |
| InChIKey | ABCGSCLPHYOHHA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|