C20H29N3O6 — CID 18342923
1-O-benzyl 4-O-tert-butyl 2-[methoxy(methyl)carbamoyl]piperazine-1,4-dicarboxylate (PubChem CID 18342923) has the molecular formula C20H29N3O6 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl 2-[methoxy(methyl)carbamoyl]piperazine-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl 2-[methoxy(methyl)carbamoyl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 18342923 |
| Molecular Formula | C20H29N3O6 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl 2-[methoxy(methyl)carbamoyl]piperazine-1,4-dicarboxylate |
| SMILES | CON(C)C(=O)C1CN(C(=O)OC(C)(C)C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O6/c1-20(2,3)29-18(25)22-11-12-23(16(13-22)17(24)21(4)27-5)19(26)28-14-15-9-7-6-8-10-15/h6-10,16H,11-14H2,1-5H3 |
| InChIKey | HRJXONRLUGVRBT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|