C24H37NO6 — CID 90773758
4-O-benzyl 1-O,3-O-ditert-butyl (3R,4R)-pyrrolidine-1,3,4-tricarboxylate;ethane (PubChem CID 90773758) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is 4-O-benzyl 1-O,3-O-ditert-butyl (3R,4R)-pyrrolidine-1,3,4-tricarboxylate;ethane.
| Compound Name | 4-O-benzyl 1-O,3-O-ditert-butyl (3R,4R)-pyrrolidine-1,3,4-tricarboxylate;ethane |
|---|---|
| PubChem CID | 90773758 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 4-O-benzyl 1-O,3-O-ditert-butyl (3R,4R)-pyrrolidine-1,3,4-tricarboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)[C@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO6.C2H6/c1-21(2,3)28-19(25)17-13-23(20(26)29-22(4,5)6)12-16(17)18(24)27-14-15-10-8-7-9-11-15;1-2/h7-11,16-17H,12-14H2,1-6H3;1-2H3/t16-,17-;/m0./s1 |
| InChIKey | AUWHZMJLBGWYFG-QJHJCNPRSA-N |
| XLogP | 4.58 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|