C18H25NO5 — CID 66985482
2-O-benzyl 1-O-tert-butyl 5-methoxypyrrolidine-1,2-dicarboxylate (PubChem CID 66985482) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl 5-methoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl 5-methoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66985482 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl 5-methoxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC1CCC(C(=O)OCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO5/c1-18(2,3)24-17(21)19-14(10-11-15(19)22-4)16(20)23-12-13-8-6-5-7-9-13/h5-9,14-15H,10-12H2,1-4H3 |
| InChIKey | BCPUNMKJXAAGNB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |