C16H21NO4 — CID 10637321
2-O-benzyl 1-O-tert-butyl (2S,3R)-3-methylaziridine-1,2-dicarboxylate (PubChem CID 10637321) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,3R)-3-methylaziridine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,3R)-3-methylaziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10637321 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,3R)-3-methylaziridine-1,2-dicarboxylate |
| SMILES | C[C@@H]1[C@@H](C(=O)OCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO4/c1-11-13(17(11)15(19)21-16(2,3)4)14(18)20-10-12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3/t11-,13+,17?/m1/s1 |
| InChIKey | HTJSSIZUCZRJDG-HWURVSIFSA-N |
| XLogP | 2.74 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|