C27H33NO8 — CID 10907216
1-O-tert-butyl 2-O,5-O-dimethyl (2R,3R,4R,5R)-3,4-bis(phenylmethoxy)pyrrolidine-1,2,5-tricarboxylate (PubChem CID 10907216) has the molecular formula C27H33NO8 and a molecular weight of 499.56 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,5-O-dimethyl (2R,3R,4R,5R)-3,4-bis(phenylmethoxy)pyrrolidine-1,2,5-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,5-O-dimethyl (2R,3R,4R,5R)-3,4-bis(phenylmethoxy)pyrrolidine-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 10907216 |
| Molecular Formula | C27H33NO8 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 1-O-tert-butyl 2-O,5-O-dimethyl (2R,3R,4R,5R)-3,4-bis(phenylmethoxy)pyrrolidine-1,2,5-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H33NO8/c1-27(2,3)36-26(31)28-20(24(29)32-4)22(34-16-18-12-8-6-9-13-18)23(21(28)25(30)33-5)35-17-19-14-10-7-11-15-19/h6-15,20-23H,16-17H2,1-5H3/t20-,21-,22-,23-/m1/s1 |
| InChIKey | FITWKNRGBIMULP-SSGKUCQKSA-N |
| XLogP | 3.49 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|