C18H25NO6 — CID 146598261
2-O-benzyl 1-O-tert-butyl 3,3-dimethoxyazetidine-1,2-dicarboxylate (PubChem CID 146598261) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl 3,3-dimethoxyazetidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl 3,3-dimethoxyazetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 146598261 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl 3,3-dimethoxyazetidine-1,2-dicarboxylate |
| SMILES | COC1(OC)CN(C(=O)OC(C)(C)C)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25NO6/c1-17(2,3)25-16(21)19-12-18(22-4,23-5)14(19)15(20)24-11-13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3 |
| InChIKey | CSMWIIQBUXWPBB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|