C19H26O4 — CID 58560493
benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclopentane-1-carboxylate (PubChem CID 58560493) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclopentane-1-carboxylate.
| Compound Name | benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 58560493 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)CC1(C(=O)OCc2ccccc2)CCCC1 |
| InChI | InChI=1S/C19H26O4/c1-18(2,3)23-16(20)13-19(11-7-8-12-19)17(21)22-14-15-9-5-4-6-10-15/h4-6,9-10H,7-8,11-14H2,1-3H3 |
| InChIKey | MRJPFMAUCXPBTC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |