C20H28O4 — CID 118208088
1-O-benzyl 4-O-tert-butyl 1-methylcyclohexane-1,4-dicarboxylate (PubChem CID 118208088) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl 1-methylcyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl 1-methylcyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118208088 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl 1-methylcyclohexane-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(C)(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H28O4/c1-19(2,3)24-17(21)16-10-12-20(4,13-11-16)18(22)23-14-15-8-6-5-7-9-15/h5-9,16H,10-14H2,1-4H3 |
| InChIKey | QKPWHGIQOVRVHB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |