C25H31NO4 — CID 167239709
dibenzyl 1,3,6-trimethylazepane-3,6-dicarboxylate (PubChem CID 167239709) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is dibenzyl 1,3,6-trimethylazepane-3,6-dicarboxylate.
| Compound Name | dibenzyl 1,3,6-trimethylazepane-3,6-dicarboxylate |
|---|---|
| PubChem CID | 167239709 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | dibenzyl 1,3,6-trimethylazepane-3,6-dicarboxylate |
| SMILES | CN1CC(C)(C(=O)OCc2ccccc2)CCC(C)(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C25H31NO4/c1-24(22(27)29-16-20-10-6-4-7-11-20)14-15-25(2,19-26(3)18-24)23(28)30-17-21-12-8-5-9-13-21/h4-13H,14-19H2,1-3H3 |
| InChIKey | ABASEVLWAAVBOV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |