C17H24N2O2 — CID 118883097
benzyl 2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 118883097) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is benzyl 2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate.
| Compound Name | benzyl 2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 118883097 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | benzyl 2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | CN1CCC2(CCCN(C(=O)OCc3ccccc3)C2)C1 |
| InChI | InChI=1S/C17H24N2O2/c1-18-11-9-17(13-18)8-5-10-19(14-17)16(20)21-12-15-6-3-2-4-7-15/h2-4,6-7H,5,8-14H2,1H3 |
| InChIKey | ZNEXRMBVVRNXDU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |