C15H20N2O4S — CID 175977278
benzyl 2,2-dioxo-2λ6-thia-1,9-diazaspiro[4.5]decane-9-carboxylate (PubChem CID 175977278) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is benzyl 2,2-dioxo-2λ6-thia-1,9-diazaspiro[4.5]decane-9-carboxylate.
| Compound Name | benzyl 2,2-dioxo-2λ6-thia-1,9-diazaspiro[4.5]decane-9-carboxylate |
|---|---|
| PubChem CID | 175977278 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | benzyl 2,2-dioxo-2λ6-thia-1,9-diazaspiro[4.5]decane-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC2(CCS(=O)(=O)N2)C1 |
| InChI | InChI=1S/C15H20N2O4S/c18-14(21-11-13-5-2-1-3-6-13)17-9-4-7-15(12-17)8-10-22(19,20)16-15/h1-3,5-6,16H,4,7-12H2 |
| InChIKey | TYGSQSPSSVJXGD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |