C15H18NO4- — CID 134129406
3-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylate (PubChem CID 134129406) has the molecular formula C15H18NO4- and a molecular weight of 276.31 g/mol. Its IUPAC name is 3-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylate.
| Compound Name | 3-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 134129406 |
| Molecular Formula | C15H18NO4- |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylate |
| SMILES | CC1(C(=O)[O-])CCCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C15H19NO4/c1-15(13(17)18)8-5-9-16(11-15)14(19)20-10-12-6-3-2-4-7-12/h2-4,6-7H,5,8-11H2,1H3,(H,17,18)/p-1 |
| InChIKey | VTRVUNGMWPPWGP-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |