benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate

C16H22N2O2 — CID 66570416

IUPACbenzyl 2,8-diazaspiro[4.5]decane-2-carboxylate
SMILESO=C(OCc1ccccc1)N1CCC2(CCNCC2)C1
InChIInChI=1S/C16H22N2O2/c19-15(20-12-14-4-2-1-3-5-14)18-11-8-16(13-18)6-9-17-10-7-16/h1-5,17H,6-13H2
InChIKeyDFQASBLNWYEDIT-UHFFFAOYSA-N
MW274.36 g/mol
LogP2.40
Rot. Bonds2

About benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate

benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 66570416) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate.

Molecular Properties

Compound Namebenzyl 2,8-diazaspiro[4.5]decane-2-carboxylate
PubChem CID66570416
Molecular FormulaC16H22N2O2
Molecular Weight274.36 g/mol
Exact Mass274.17
IUPAC Namebenzyl 2,8-diazaspiro[4.5]decane-2-carboxylate
SMILESO=C(OCc1ccccc1)N1CCC2(CCNCC2)C1
InChIInChI=1S/C16H22N2O2/c19-15(20-12-14-4-2-1-3-5-14)18-11-8-16(13-18)6-9-17-10-7-16/h1-5,17H,6-13H2
InChIKeyDFQASBLNWYEDIT-UHFFFAOYSA-N
XLogP2.40
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 52.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate?
The IUPAC name of benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate (CID 66570416) is benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate.
What is the SMILES notation for benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate?
The canonical SMILES for benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate is O=C(OCc1ccccc1)N1CCC2(CCNCC2)C1.
What is the InChIKey of benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate?
The InChIKey is DFQASBLNWYEDIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c19-15(20-12-14-4-2-1-3-5-14)18-11-8-16(13-18)6-9-17-10-7-16/h1-5,17H,6-13H2.
What are the key properties of benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate?
benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate has a molecular weight of 274.36 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate is sourced from PubChem (CID 66570416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).