C16H22N2O2 — CID 66570416
benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 66570416) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 66570416 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | benzyl 2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C16H22N2O2/c19-15(20-12-14-4-2-1-3-5-14)18-11-8-16(13-18)6-9-17-10-7-16/h1-5,17H,6-13H2 |
| InChIKey | DFQASBLNWYEDIT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |