C21H26N2O5S — CID 138393666
benzyl 2,6-diazaspiro[3.4]octane-6-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 138393666) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is benzyl 2,6-diazaspiro[3.4]octane-6-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | benzyl 2,6-diazaspiro[3.4]octane-6-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 138393666 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | benzyl 2,6-diazaspiro[3.4]octane-6-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C(OCc1ccccc1)N1CCC2(CNC2)C1 |
| InChI | InChI=1S/C14H18N2O2.C7H8O3S/c17-13(18-8-12-4-2-1-3-5-12)16-7-6-14(11-16)9-15-10-14;1-6-2-4-7(5-3-6)11(8,9)10/h1-5,15H,6-11H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | NKGGQRIPVHFWHN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|