C29H35N3O6S — CID 19591394
benzyl 4-(dimethylaminocarbamoyl)-4-phenylpiperidine-1-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 19591394) has the molecular formula C29H35N3O6S and a molecular weight of 553.68 g/mol. Its IUPAC name is benzyl 4-(dimethylaminocarbamoyl)-4-phenylpiperidine-1-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | benzyl 4-(dimethylaminocarbamoyl)-4-phenylpiperidine-1-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19591394 |
| Molecular Formula | C29H35N3O6S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | benzyl 4-(dimethylaminocarbamoyl)-4-phenylpiperidine-1-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | CN(C)NC(=O)C1(c2ccccc2)CCN(C(=O)OCc2ccccc2)CC1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H27N3O3.C7H8O3S/c1-24(2)23-20(26)22(19-11-7-4-8-12-19)13-15-25(16-14-22)21(27)28-17-18-9-5-3-6-10-18;1-6-2-4-7(5-3-6)11(8,9)10/h3-12H,13-17H2,1-2H3,(H,23,26);2-5H,1H3,(H,8,9,10) |
| InChIKey | YUWPSANIGRTNHQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|