C25H24FNO4S — CID 123454368
benzyl 3-(4-fluorophenyl)sulfonyl-3-(4-methylphenyl)pyrrolidine-1-carboxylate (PubChem CID 123454368) has the molecular formula C25H24FNO4S and a molecular weight of 453.54 g/mol. Its IUPAC name is benzyl 3-(4-fluorophenyl)sulfonyl-3-(4-methylphenyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-(4-fluorophenyl)sulfonyl-3-(4-methylphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123454368 |
| Molecular Formula | C25H24FNO4S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | benzyl 3-(4-fluorophenyl)sulfonyl-3-(4-methylphenyl)pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H24FNO4S/c1-19-7-9-21(10-8-19)25(32(29,30)23-13-11-22(26)12-14-23)15-16-27(18-25)24(28)31-17-20-5-3-2-4-6-20/h2-14H,15-18H2,1H3 |
| InChIKey | UJNATTOSOCNDED-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |