C27H28FNO5S — CID 57030070
benzyl (3S,4R)-4-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate (PubChem CID 57030070) has the molecular formula C27H28FNO5S and a molecular weight of 497.59 g/mol. Its IUPAC name is benzyl (3S,4R)-4-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate.
| Compound Name | benzyl (3S,4R)-4-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57030070 |
| Molecular Formula | C27H28FNO5S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | benzyl (3S,4R)-4-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CN(C(=O)OCc3ccccc3)CC[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H28FNO5S/c1-20-7-13-25(14-8-20)35(31,32)34-19-23-17-29(27(30)33-18-21-5-3-2-4-6-21)16-15-26(23)22-9-11-24(28)12-10-22/h2-14,23,26H,15-19H2,1H3/t23-,26-/m0/s1 |
| InChIKey | IHKBYBIEALKFLC-OZXSUGGESA-N |
| XLogP | 5.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|