benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate

C18H18FNO2 — CID 130472055

IUPACbenzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CCC(c2ccc(F)cc2)C1
InChIInChI=1S/C18H18FNO2/c19-17-8-6-15(7-9-17)16-10-11-20(12-16)18(21)22-13-14-4-2-1-3-5-14/h1-9,16H,10-13H2
InChIKeyUGFXWOUMSOAFFS-UHFFFAOYSA-N
MW299.35 g/mol
LogP3.95
Rot. Bonds3

About benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate

benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 130472055) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate
PubChem CID130472055
Molecular FormulaC18H18FNO2
Molecular Weight299.35 g/mol
Exact Mass299.13
IUPAC Namebenzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CCC(c2ccc(F)cc2)C1
InChIInChI=1S/C18H18FNO2/c19-17-8-6-15(7-9-17)16-10-11-20(12-16)18(21)22-13-14-4-2-1-3-5-14/h1-9,16H,10-13H2
InChIKeyUGFXWOUMSOAFFS-UHFFFAOYSA-N
XLogP3.95
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.35
LogP ≤ 53.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate (CID 130472055) is benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate is O=C(OCc1ccccc1)N1CCC(c2ccc(F)cc2)C1.
What is the InChIKey of benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate?
The InChIKey is UGFXWOUMSOAFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO2/c19-17-8-6-15(7-9-17)16-10-11-20(12-16)18(21)22-13-14-4-2-1-3-5-14/h1-9,16H,10-13H2.
What are the key properties of benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate?
benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate has a molecular weight of 299.35 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(4-fluorophenyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 130472055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).