C20H24N2O5S — CID 72529595
benzyl 4-amino-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate (PubChem CID 72529595) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is benzyl 4-amino-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate.
| Compound Name | benzyl 4-amino-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 72529595 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | benzyl 4-amino-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CN(C(=O)OCc3ccccc3)CCC2N)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-15-7-9-17(10-8-15)28(24,25)27-19-13-22(12-11-18(19)21)20(23)26-14-16-5-3-2-4-6-16/h2-10,18-19H,11-14,21H2,1H3 |
| InChIKey | XVIBCNQBYCYALT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|