About benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate
benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate (PubChem CID 89036885) has the molecular formula C25H31NO5S
and a molecular weight of 457.59 g/mol. Its IUPAC name is benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate |
| PubChem CID | 89036885 |
| Molecular Formula | C25H31NO5S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2C[C@@H]2C2CCN(C(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H31NO5S/c1-19-7-9-23(10-8-19)32(28,29)31-16-13-22-17-24(22)21-11-14-26(15-12-21)25(27)30-18-20-5-3-2-4-6-20/h2-10,21-22,24H,11-18H2,1H3/t22-,24-/m1/s1 |
| InChIKey | KTVJEALBXYDEAN-ISKFKSNPSA-N |
| XLogP | 4.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate?
The IUPAC name of benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate (CID 89036885) is benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate.
What is the SMILES notation for benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate?
The canonical SMILES for benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate is Cc1ccc(S(=O)(=O)OCC[C@@H]2C[C@@H]2C2CCN(C(=O)OCc3ccccc3)CC2)cc1.
What is the InChIKey of benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate?
The InChIKey is KTVJEALBXYDEAN-ISKFKSNPSA-N. The full InChI is InChI=1S/C25H31NO5S/c1-19-7-9-23(10-8-19)32(28,29)31-16-13-22-17-24(22)21-11-14-26(15-12-21)25(27)30-18-20-5-3-2-4-6-20/h2-10,21-22,24H,11-18H2,1H3/t22-,24-/m1/s1.
What are the key properties of benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate?
benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate has a molecular weight of 457.59 g/mol, XLogP of 4.78, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[(1R,2S)-2-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]piperidine-1-carboxylate is sourced from PubChem (CID 89036885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).