C24H29N3O5 — CID 70819067
benzyl 4-[(1R,2S)-2-[2-[(3-methyl-5-nitro-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidine-1-carboxylate (PubChem CID 70819067) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is benzyl 4-[(1R,2S)-2-[2-[(3-methyl-5-nitro-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(1R,2S)-2-[2-[(3-methyl-5-nitro-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70819067 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | benzyl 4-[(1R,2S)-2-[2-[(3-methyl-5-nitro-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidine-1-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])cnc1OCC[C@@H]1C[C@@H]1C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O5/c1-17-13-21(27(29)30)15-25-23(17)31-12-9-20-14-22(20)19-7-10-26(11-8-19)24(28)32-16-18-5-3-2-4-6-18/h2-6,13,15,19-20,22H,7-12,14,16H2,1H3/t20-,22-/m1/s1 |
| InChIKey | AVLCBYKTSPLUPH-IFMALSPDSA-N |
| XLogP | 4.75 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|