C25H32N2O7S — CID 171058111
benzyl 4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (PubChem CID 171058111) has the molecular formula C25H32N2O7S and a molecular weight of 504.61 g/mol. Its IUPAC name is benzyl 4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171058111 |
| Molecular Formula | C25H32N2O7S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | benzyl 4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCN(C(=O)OCc3ccccc3)CC2NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H32N2O7S/c1-18-10-12-20(13-11-18)35(30,31)34-22-14-15-27(16-21(22)26-23(28)33-25(2,3)4)24(29)32-17-19-8-6-5-7-9-19/h5-13,21-22H,14-17H2,1-4H3,(H,26,28) |
| InChIKey | LGAVEHGLQIBMPP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|