C19H28N2O7S — CID 88862464
benzyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 88862464) has the molecular formula C19H28N2O7S and a molecular weight of 428.51 g/mol. Its IUPAC name is benzyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 88862464 |
| Molecular Formula | C19H28N2O7S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | benzyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(C(=O)OCc2ccccc2)CCC1OS(C)(=O)=O |
| InChI | InChI=1S/C19H28N2O7S/c1-19(2,3)27-17(22)20-15-12-21(11-10-16(15)28-29(4,24)25)18(23)26-13-14-8-6-5-7-9-14/h5-9,15-16H,10-13H2,1-4H3,(H,20,22)/t15-,16?/m0/s1 |
| InChIKey | ONROOVAFYDOERF-VYRBHSGPSA-N |
| XLogP | 2.27 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|