C19H25N3O5 — CID 139448708
benzyl (4S)-3-isocyanato-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (PubChem CID 139448708) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is benzyl (4S)-3-isocyanato-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate.
| Compound Name | benzyl (4S)-3-isocyanato-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139448708 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | benzyl (4S)-3-isocyanato-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(C(=O)OCc2ccccc2)CC1N=C=O |
| InChI | InChI=1S/C19H25N3O5/c1-19(2,3)27-17(24)21-15-9-10-22(11-16(15)20-13-23)18(25)26-12-14-7-5-4-6-8-14/h4-8,15-16H,9-12H2,1-3H3,(H,21,24)/t15-,16?/m0/s1 |
| InChIKey | VIVLMLHIAQDKSU-VYRBHSGPSA-N |
| XLogP | 2.63 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|