C17H15FINO4S — CID 174821526
(3S)-3-(4-fluorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-1-carboxylic acid (PubChem CID 174821526) has the molecular formula C17H15FINO4S and a molecular weight of 475.28 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (3S)-3-(4-fluorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174821526 |
| Molecular Formula | C17H15FINO4S |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 474.98 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)sulfonyl-3-(4-iodophenyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@@](c2ccc(I)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H15FINO4S/c18-13-3-7-15(8-4-13)25(23,24)17(9-10-20(11-17)16(21)22)12-1-5-14(19)6-2-12/h1-8H,9-11H2,(H,21,22)/t17-/m1/s1 |
| InChIKey | SHOYYUPVFKTXEU-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|