C26H24F8N2O7S2 — CID 118208007
[4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamic acid (PubChem CID 118208007) has the molecular formula C26H24F8N2O7S2 and a molecular weight of 692.60 g/mol. Its IUPAC name is [4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamic acid.
| Compound Name | [4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamic acid |
|---|---|
| PubChem CID | 118208007 |
| Molecular Formula | C26H24F8N2O7S2 |
| Molecular Weight | 692.60 g/mol |
| Exact Mass | 692.09 |
| IUPAC Name | [4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamic acid |
| SMILES | O=C(O)NC1(C(=O)N2CCC(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C26H24F8N2O7S2/c27-18-5-7-19(8-6-18)45(42,43)23(16-1-3-17(4-2-16)24(28,25(29,30)31)26(32,33)34)9-12-36(15-23)20(37)22(35-21(38)39)10-13-44(40,41)14-11-22/h1-8,35H,9-15H2,(H,38,39) |
| InChIKey | VNZCIVDXTDLGKF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |