C27H26F8N2O4S2 — CID 118209369
4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-N-methylthiane-4-carboxamide (PubChem CID 118209369) has the molecular formula C27H26F8N2O4S2 and a molecular weight of 658.63 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-N-methylthiane-4-carboxamide.
| Compound Name | 4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-N-methylthiane-4-carboxamide |
|---|---|
| PubChem CID | 118209369 |
| Molecular Formula | C27H26F8N2O4S2 |
| Molecular Weight | 658.63 g/mol |
| Exact Mass | 658.12 |
| IUPAC Name | 4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-N-methylthiane-4-carboxamide |
| SMILES | CNC(=O)C1(C(=O)N2CCC(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCSCC1 |
| InChI | InChI=1S/C27H26F8N2O4S2/c1-36-21(38)23(11-14-42-15-12-23)22(39)37-13-10-24(16-37,43(40,41)20-8-6-19(28)7-9-20)17-2-4-18(5-3-17)25(29,26(30,31)32)27(33,34)35/h2-9H,10-16H2,1H3,(H,36,38) |
| InChIKey | UGULNUQNXKFEMM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|