C28H28F8N2O6S2 — CID 123730687
N-ethyl-4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothiane-4-carboxamide (PubChem CID 123730687) has the molecular formula C28H28F8N2O6S2 and a molecular weight of 704.66 g/mol. Its IUPAC name is N-ethyl-4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-ethyl-4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 123730687 |
| Molecular Formula | C28H28F8N2O6S2 |
| Molecular Weight | 704.66 g/mol |
| Exact Mass | 704.13 |
| IUPAC Name | N-ethyl-4-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothiane-4-carboxamide |
| SMILES | CCNC(=O)C1(C(=O)N2CCC(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C28H28F8N2O6S2/c1-2-37-22(39)24(12-15-45(41,42)16-13-24)23(40)38-14-11-25(17-38,46(43,44)21-9-7-20(29)8-10-21)18-3-5-19(6-4-18)26(30,27(31,32)33)28(34,35)36/h3-10H,2,11-17H2,1H3,(H,37,39) |
| InChIKey | SCAROKUNRDGRHY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|