C28H30F8N2O5S2 — CID 118217940
[4-[(dimethylamino)methyl]-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118217940) has the molecular formula C28H30F8N2O5S2 and a molecular weight of 690.68 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | [4-[(dimethylamino)methyl]-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118217940 |
| Molecular Formula | C28H30F8N2O5S2 |
| Molecular Weight | 690.68 g/mol |
| Exact Mass | 690.15 |
| IUPAC Name | [4-[(dimethylamino)methyl]-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | CN(C)CC1(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C28H30F8N2O5S2/c1-37(2)17-24(12-15-44(40,41)16-13-24)23(39)38-14-11-25(18-38,45(42,43)22-9-7-21(29)8-10-22)19-3-5-20(6-4-19)26(30,27(31,32)33)28(34,35)36/h3-10H,11-18H2,1-2H3/t25-/m0/s1 |
| InChIKey | PMHXAHBIWLORNQ-VWLOTQADSA-N |
| XLogP | 4.77 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |