C27H26F8N2O7S2 — CID 118217939
methyl N-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamate (PubChem CID 118217939) has the molecular formula C27H26F8N2O7S2 and a molecular weight of 706.63 g/mol. Its IUPAC name is methyl N-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamate.
| Compound Name | methyl N-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamate |
|---|---|
| PubChem CID | 118217939 |
| Molecular Formula | C27H26F8N2O7S2 |
| Molecular Weight | 706.63 g/mol |
| Exact Mass | 706.11 |
| IUPAC Name | methyl N-[4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-1,1-dioxothian-4-yl]carbamate |
| SMILES | COC(=O)NC1(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C27H26F8N2O7S2/c1-44-22(39)36-23(11-14-45(40,41)15-12-23)21(38)37-13-10-24(16-37,46(42,43)20-8-6-19(28)7-9-20)17-2-4-18(5-3-17)25(29,26(30,31)32)27(33,34)35/h2-9H,10-16H2,1H3,(H,36,39)/t24-/m0/s1 |
| InChIKey | OWNWCGTYQRITOQ-DEOSSOPVSA-N |
| XLogP | 4.32 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |