C25H24F8N2O3S — CID 118217589
(1-aminocyclopentyl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118217589) has the molecular formula C25H24F8N2O3S and a molecular weight of 584.53 g/mol. Its IUPAC name is (1-aminocyclopentyl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | (1-aminocyclopentyl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118217589 |
| Molecular Formula | C25H24F8N2O3S |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | (1-aminocyclopentyl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCCC1 |
| InChI | InChI=1S/C25H24F8N2O3S/c26-18-7-9-19(10-8-18)39(37,38)22(13-14-35(15-22)20(36)21(34)11-1-2-12-21)16-3-5-17(6-4-16)23(27,24(28,29)30)25(31,32)33/h3-10H,1-2,11-15,34H2/t22-/m0/s1 |
| InChIKey | XQDBTOZUHSONFS-QFIPXVFZSA-N |
| XLogP | 5.29 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |