C25H19F8N3O3S — CID 123180922
1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone (PubChem CID 123180922) has the molecular formula C25H19F8N3O3S and a molecular weight of 593.50 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone.
| Compound Name | 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone |
|---|---|
| PubChem CID | 123180922 |
| Molecular Formula | C25H19F8N3O3S |
| Molecular Weight | 593.50 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone |
| SMILES | O=C(Cc1cncnc1)N1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H19F8N3O3S/c26-19-5-7-20(8-6-19)40(38,39)22(9-10-36(14-22)21(37)11-16-12-34-15-35-13-16)17-1-3-18(4-2-17)23(27,24(28,29)30)25(31,32)33/h1-8,12-13,15H,9-11,14H2 |
| InChIKey | IDSHAHAJAMJIAX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |