C27H25F8N5O3S — CID 123975552
[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(2H-tetrazol-5-yl)cyclohexyl]methanone (PubChem CID 123975552) has the molecular formula C27H25F8N5O3S and a molecular weight of 651.58 g/mol. Its IUPAC name is [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(2H-tetrazol-5-yl)cyclohexyl]methanone.
| Compound Name | [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(2H-tetrazol-5-yl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 123975552 |
| Molecular Formula | C27H25F8N5O3S |
| Molecular Weight | 651.58 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(2H-tetrazol-5-yl)cyclohexyl]methanone |
| SMILES | O=C(C1CCC(c2nn[nH]n2)CC1)N1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H25F8N5O3S/c28-20-9-11-21(12-10-20)44(42,43)24(18-5-7-19(8-6-18)25(29,26(30,31)32)27(33,34)35)13-14-40(15-24)23(41)17-3-1-16(2-4-17)22-36-38-39-37-22/h5-12,16-17H,1-4,13-15H2,(H,36,37,38,39) |
| InChIKey | WBIWHHCDLUJJER-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |